C12H23NO5S — CID 131123206
[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl] methanesulfonate (PubChem CID 131123206) has the molecular formula C12H23NO5S and a molecular weight of 293.39 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl] methanesulfonate.
| Compound Name | [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl] methanesulfonate |
|---|---|
| PubChem CID | 131123206 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CC(OS(C)(=O)=O)C1(C)C |
| InChI | InChI=1S/C12H23NO5S/c1-11(2,3)17-10(14)13-8-7-9(12(8,4)5)18-19(6,15)16/h8-9H,7H2,1-6H3,(H,13,14) |
| InChIKey | QZKNVHXXWFKQHZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|