C8H13F2NO2 — CID 52908307
tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate (PubChem CID 52908307) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate |
|---|---|
| PubChem CID | 52908307 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC1(F)F |
| InChI | InChI=1S/C8H13F2NO2/c1-7(2,3)13-6(12)11-5-4-8(5,9)10/h5H,4H2,1-3H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | NZWXSCJTYUJHFF-YFKPBYRVSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |