C9H16F2N2O2 — CID 124523315
tert-butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate (PubChem CID 124523315) has the molecular formula C9H16F2N2O2 and a molecular weight of 222.23 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 124523315 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | tert-butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCC1(F)F |
| InChI | InChI=1S/C9H16F2N2O2/c1-8(2,3)15-7(14)13-6-4-12-5-9(6,10)11/h6,12H,4-5H2,1-3H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | AYPWPGOPAZUJDF-LURJTMIESA-N |
| XLogP | 1.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |