C10H17F2NO2 — CID 66792233
tert-butyl N-(2,2-difluorocyclopentyl)carbamate (PubChem CID 66792233) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluorocyclopentyl)carbamate.
| Compound Name | tert-butyl N-(2,2-difluorocyclopentyl)carbamate |
|---|---|
| PubChem CID | 66792233 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | tert-butyl N-(2,2-difluorocyclopentyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC1(F)F |
| InChI | InChI=1S/C10H17F2NO2/c1-9(2,3)15-8(14)13-7-5-4-6-10(7,11)12/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | MNXNTXJELBUAIP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |