C11H18F2N4O2 — CID 123311477
tert-butyl N-[(1S,2S)-2-azido-3,3-difluorocyclohexyl]carbamate (PubChem CID 123311477) has the molecular formula C11H18F2N4O2 and a molecular weight of 276.29 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-azido-3,3-difluorocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-azido-3,3-difluorocyclohexyl]carbamate |
|---|---|
| PubChem CID | 123311477 |
| Molecular Formula | C11H18F2N4O2 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-azido-3,3-difluorocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC(F)(F)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H18F2N4O2/c1-10(2,3)19-9(18)15-7-5-4-6-11(12,13)8(7)16-17-14/h7-8H,4-6H2,1-3H3,(H,15,18)/t7-,8-/m0/s1 |
| InChIKey | JPFHYVPXCRPATB-YUMQZZPRSA-N |
| XLogP | 3.38 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|