C11H20N4O3 — CID 151269227
tert-butyl N-(2-azido-4-hydroxycyclohexyl)carbamate (PubChem CID 151269227) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is tert-butyl N-(2-azido-4-hydroxycyclohexyl)carbamate.
| Compound Name | tert-butyl N-(2-azido-4-hydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 151269227 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl N-(2-azido-4-hydroxycyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C11H20N4O3/c1-11(2,3)18-10(17)13-8-5-4-7(16)6-9(8)14-15-12/h7-9,16H,4-6H2,1-3H3,(H,13,17) |
| InChIKey | NVZOTGKZUFFERQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|