C18H31N5O6 — CID 101494409
methyl (1R,2R,4S,5S)-5-azido-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (PubChem CID 101494409) has the molecular formula C18H31N5O6 and a molecular weight of 413.48 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S)-5-azido-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S)-5-azido-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101494409 |
| Molecular Formula | C18H31N5O6 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | methyl (1R,2R,4S,5S)-5-azido-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](N=[N+]=[N-])[C@@H](NC(=O)OC(C)(C)C)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O6/c1-17(2,3)28-15(25)20-11-9-12(21-16(26)29-18(4,5)6)13(22-23-19)8-10(11)14(24)27-7/h10-13H,8-9H2,1-7H3,(H,20,25)(H,21,26)/t10-,11-,12+,13+/m1/s1 |
| InChIKey | TUVHPFQSOAXTEP-NDBYEHHHSA-N |
| XLogP | 3.03 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|