C11H18N4O4 — CID 170910638
cis-(3S,4R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (PubChem CID 170910638) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is cis-(3S,4R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(3S,4R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 170910638 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | cis-(3S,4R)-3-azido-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC(C(=O)O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H18N4O4/c1-11(2,3)19-10(18)13-7-4-6(9(16)17)5-8(7)14-15-12/h6-8H,4-5H2,1-3H3,(H,13,18)(H,16,17)/t6?,7-,8+/m1/s1 |
| InChIKey | RYBKTKNVMIWQTG-VVXQKDJTSA-N |
| XLogP | 2.05 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|