C11H20N4O4 — CID 102168738
tert-butyl N-[(1R,2S,3S,4R)-2-azido-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamate (PubChem CID 102168738) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S,4R)-2-azido-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S,4R)-2-azido-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 102168738 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S,4R)-2-azido-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CO)[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H20N4O4/c1-11(2,3)19-10(18)13-7-4-6(5-16)9(17)8(7)14-15-12/h6-9,16-17H,4-5H2,1-3H3,(H,13,18)/t6-,7-,8+,9+/m1/s1 |
| InChIKey | KDUIYLGCAQIGMV-HXFLIBJXSA-N |
| XLogP | 0.93 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|