C8H15N3O3 — CID 59974124
trans-(4R,6R)-3-azido-6-(hydroxymethyl)-4-methylcyclohexane-1,2-diol (PubChem CID 59974124) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is trans-(4R,6R)-3-azido-6-(hydroxymethyl)-4-methylcyclohexane-1,2-diol.
| Compound Name | trans-(4R,6R)-3-azido-6-(hydroxymethyl)-4-methylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 59974124 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | trans-(4R,6R)-3-azido-6-(hydroxymethyl)-4-methylcyclohexane-1,2-diol |
| SMILES | C[C@@H]1C[C@H](CO)C(O)C(O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C8H15N3O3/c1-4-2-5(3-12)7(13)8(14)6(4)10-11-9/h4-8,12-14H,2-3H2,1H3/t4-,5-,6?,7?,8?/m1/s1 |
| InChIKey | PVEIUDDCVMTYNB-LRGMQIARSA-N |
| XLogP | 0.04 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|