C6H11N3O5 — CID 130197819
(2R,3S,5R)-3-azido-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 130197819) has the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. Its IUPAC name is (2R,3S,5R)-3-azido-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3S,5R)-3-azido-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 130197819 |
| Molecular Formula | C6H11N3O5 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2R,3S,5R)-3-azido-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | [N-]=[N+]=N[C@H]1C(O)[C@@H](O)C(CO)O[C@H]1O |
| InChI | InChI=1S/C6H11N3O5/c7-9-8-3-5(12)4(11)2(1-10)14-6(3)13/h2-6,10-13H,1H2/t2?,3-,4-,5?,6+/m0/s1 |
| InChIKey | URARQBMUQIRZQO-DLGJCNIVSA-N |
| XLogP | -1.90 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|