C6H10ClN3O4 — CID 140821044
(2S,4S,5R)-4-azido-2-chloro-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 140821044) has the molecular formula C6H10ClN3O4 and a molecular weight of 223.62 g/mol. Its IUPAC name is (2S,4S,5R)-4-azido-2-chloro-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2S,4S,5R)-4-azido-2-chloro-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 140821044 |
| Molecular Formula | C6H10ClN3O4 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (2S,4S,5R)-4-azido-2-chloro-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | [N-]=[N+]=N[C@@H]1C(O)[C@H](Cl)OC(CO)[C@@H]1O |
| InChI | InChI=1S/C6H10ClN3O4/c7-6-5(13)3(9-10-8)4(12)2(1-11)14-6/h2-6,11-13H,1H2/t2?,3-,4-,5?,6+/m0/s1 |
| InChIKey | AKDWLPSJLOMBEJ-DLGJCNIVSA-N |
| XLogP | -0.66 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|