C6H11N3O4 — CID 130936452
(2R,3S,4R)-4-azido-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (PubChem CID 130936452) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2R,3S,4R)-4-azido-2-(hydroxymethyl)-5-methoxyoxolan-3-ol.
| Compound Name | (2R,3S,4R)-4-azido-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 130936452 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | (2R,3S,4R)-4-azido-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| SMILES | COC1O[C@H](CO)[C@@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C6H11N3O4/c1-12-6-4(8-9-7)5(11)3(2-10)13-6/h3-6,10-11H,2H2,1H3/t3-,4-,5-,6?/m1/s1 |
| InChIKey | IDFFSXQBWJOKCG-JDJSBBGDSA-N |
| XLogP | -0.61 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|