C9H17N3O4 — CID 70914870
(3S,6S)-4-azido-2-(hydroxymethyl)-6-propan-2-yloxane-3,5-diol (PubChem CID 70914870) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3S,6S)-4-azido-2-(hydroxymethyl)-6-propan-2-yloxane-3,5-diol.
| Compound Name | (3S,6S)-4-azido-2-(hydroxymethyl)-6-propan-2-yloxane-3,5-diol |
|---|---|
| PubChem CID | 70914870 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (3S,6S)-4-azido-2-(hydroxymethyl)-6-propan-2-yloxane-3,5-diol |
| SMILES | CC(C)[C@@H]1OC(CO)[C@@H](O)C(N=[N+]=[N-])C1O |
| InChI | InChI=1S/C9H17N3O4/c1-4(2)9-8(15)6(11-12-10)7(14)5(3-13)16-9/h4-9,13-15H,3H2,1-2H3/t5?,6?,7-,8?,9+/m1/s1 |
| InChIKey | RQEJQGQYCRYHLX-YJBNNMDESA-N |
| XLogP | -0.20 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|