C7H12N6O3 — CID 101338794
(2R,3R,4R,5S,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-ol (PubChem CID 101338794) has the molecular formula C7H12N6O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-ol.
| Compound Name | (2R,3R,4R,5S,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 101338794 |
| Molecular Formula | C7H12N6O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3,5-diazido-2-methoxy-6-methyloxan-4-ol |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](N=[N+]=[N-])[C@@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C7H12N6O3/c1-3-4(10-12-8)6(14)5(11-13-9)7(15-2)16-3/h3-7,14H,1-2H3/t3-,4+,5+,6+,7+/m0/s1 |
| InChIKey | CFTOVUMMLZUTRW-CQOGJGKDSA-N |
| XLogP | 1.10 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|