C7H12N4O4 — CID 155490214
(2S,3S,4R)-3-azido-4-hydroxy-5-methoxy-N-methyloxolane-2-carboxamide (PubChem CID 155490214) has the molecular formula C7H12N4O4 and a molecular weight of 216.20 g/mol. Its IUPAC name is (2S,3S,4R)-3-azido-4-hydroxy-5-methoxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R)-3-azido-4-hydroxy-5-methoxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 155490214 |
| Molecular Formula | C7H12N4O4 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (2S,3S,4R)-3-azido-4-hydroxy-5-methoxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1OC(OC)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C7H12N4O4/c1-9-6(13)5-3(10-11-8)4(12)7(14-2)15-5/h3-5,7,12H,1-2H3,(H,9,13)/t3-,4+,5-,7?/m0/s1 |
| InChIKey | GHFNDQMXLUNZTH-JHPPHWPESA-N |
| XLogP | -0.86 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|