C10H20N3O6P — CID 11141389
(2R,3R,4R,5S)-4-azido-5-(diethoxyphosphorylmethyl)-2-methoxyoxolan-3-ol (PubChem CID 11141389) has the molecular formula C10H20N3O6P and a molecular weight of 309.26 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-azido-5-(diethoxyphosphorylmethyl)-2-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-azido-5-(diethoxyphosphorylmethyl)-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 11141389 |
| Molecular Formula | C10H20N3O6P |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R,3R,4R,5S)-4-azido-5-(diethoxyphosphorylmethyl)-2-methoxyoxolan-3-ol |
| SMILES | CCOP(=O)(C[C@H]1O[C@@H](OC)[C@H](O)[C@H]1N=[N+]=[N-])OCC |
| InChI | InChI=1S/C10H20N3O6P/c1-4-17-20(15,18-5-2)6-7-8(12-13-11)9(14)10(16-3)19-7/h7-10,14H,4-6H2,1-3H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | JGKXXUQXUAKOSY-UTINFBMNSA-N |
| XLogP | 1.66 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|