C12H23Br2O8P — CID 72722207
(2R,3S,4S,5R,6S)-2-(2,2-dibromo-2-diethoxyphosphorylethyl)-6-methoxyoxane-3,4,5-triol (PubChem CID 72722207) has the molecular formula C12H23Br2O8P and a molecular weight of 486.09 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(2,2-dibromo-2-diethoxyphosphorylethyl)-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(2,2-dibromo-2-diethoxyphosphorylethyl)-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 72722207 |
| Molecular Formula | C12H23Br2O8P |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(2,2-dibromo-2-diethoxyphosphorylethyl)-6-methoxyoxane-3,4,5-triol |
| SMILES | CCOP(=O)(OCC)C(Br)(Br)C[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23Br2O8P/c1-4-20-23(18,21-5-2)12(13,14)6-7-8(15)9(16)10(17)11(19-3)22-7/h7-11,15-17H,4-6H2,1-3H3/t7-,8-,9+,10-,11+/m1/s1 |
| InChIKey | IOMUSYKIJIJPRU-NZFPMDFQSA-N |
| XLogP | 1.54 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|