C12H25O9P — CID 10759843
(2S,3S,4S,5S,6S)-2-[(1S)-2-diethoxyphosphoryl-1-hydroxyethyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 10759843) has the molecular formula C12H25O9P and a molecular weight of 344.30 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-2-[(1S)-2-diethoxyphosphoryl-1-hydroxyethyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6S)-2-[(1S)-2-diethoxyphosphoryl-1-hydroxyethyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10759843 |
| Molecular Formula | C12H25O9P |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2S,3S,4S,5S,6S)-2-[(1S)-2-diethoxyphosphoryl-1-hydroxyethyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CCOP(=O)(C[C@@H](O)[C@H]1O[C@H](OC)[C@@H](O)[C@@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C12H25O9P/c1-4-19-22(17,20-5-2)6-7(13)11-9(15)8(14)10(16)12(18-3)21-11/h7-16H,4-6H2,1-3H3/t7-,8+,9+,10+,11-,12+/m1/s1 |
| InChIKey | HZCRSFGZUWFPHB-QAWJZHMJSA-N |
| XLogP | -0.93 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|