C8H17O10P — CID 100966696
[(2R,3R,4S,5S,6R)-2-[(1S)-1,2-dihydroxyethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl] dihydrogen phosphate (PubChem CID 100966696) has the molecular formula C8H17O10P and a molecular weight of 304.19 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-[(1S)-1,2-dihydroxyethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-[(1S)-1,2-dihydroxyethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 100966696 |
| Molecular Formula | C8H17O10P |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-[(1S)-1,2-dihydroxyethyl]-3,5-dihydroxy-6-methoxyoxan-4-yl] dihydrogen phosphate |
| SMILES | CO[C@@H]1O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](OP(=O)(O)O)[C@@H]1O |
| InChI | InChI=1S/C8H17O10P/c1-16-8-5(12)7(18-19(13,14)15)4(11)6(17-8)3(10)2-9/h3-12H,2H2,1H3,(H2,13,14,15)/t3-,4+,5-,6+,7-,8+/m0/s1 |
| InChIKey | FVGRNBIGRSPAMQ-NTZPWTIWSA-N |
| XLogP | -3.09 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|