C8H17O9P — CID 10782771
[(2R)-2-hydroxy-2-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]phosphonic acid (PubChem CID 10782771) has the molecular formula C8H17O9P and a molecular weight of 288.19 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]phosphonic acid.
| Compound Name | [(2R)-2-hydroxy-2-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 10782771 |
| Molecular Formula | C8H17O9P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [(2R)-2-hydroxy-2-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]phosphonic acid |
| SMILES | CO[C@H]1O[C@H]([C@@H](O)CP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17O9P/c1-16-8-6(12)4(10)5(11)7(17-8)3(9)2-18(13,14)15/h3-12H,2H2,1H3,(H2,13,14,15)/t3-,4-,5-,6-,7+,8-/m0/s1 |
| InChIKey | VTGMELVESKBFTB-IHKZFYOVSA-N |
| XLogP | -3.02 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|