C7H13O10P-2 — CID 46878581
[(3S,4S,5S,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] phosphate (PubChem CID 46878581) has the molecular formula C7H13O10P-2 and a molecular weight of 288.15 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] phosphate.
| Compound Name | [(3S,4S,5S,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] phosphate |
|---|---|
| PubChem CID | 46878581 |
| Molecular Formula | C7H13O10P-2 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | [(3S,4S,5S,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])OC1O[C@H]([C@H](O)CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H15O10P/c8-1-2(9)6-4(11)3(10)5(12)7(16-6)17-18(13,14)15/h2-12H,1H2,(H2,13,14,15)/p-2/t2-,3+,4+,5+,6-,7?/m1/s1 |
| InChIKey | KMEJCSKJXSBBAN-NNPWBXLPSA-L |
| XLogP | -5.01 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|