C8H16O7 — CID 18664777
(2R,3S,4S,5R)-2-[(1R)-1,2-dihydroxyethyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 18664777) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[(1R)-1,2-dihydroxyethyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-[(1R)-1,2-dihydroxyethyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 18664777 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (2R,3S,4S,5R)-2-[(1R)-1,2-dihydroxyethyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | COC1O[C@H]([C@H](O)CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O7/c1-14-8-6(13)4(11)5(12)7(15-8)3(10)2-9/h3-13H,2H2,1H3/t3-,4+,5+,6-,7-,8?/m1/s1 |
| InChIKey | GJUAFBSAJCBGRU-PVSKYMLXSA-N |
| XLogP | -3.21 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |