C6H13O9P — CID 101460402
[(2S,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate (PubChem CID 101460402) has the molecular formula C6H13O9P and a molecular weight of 260.14 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate.
| Compound Name | [(2S,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101460402 |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [(2S,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@@H]1O[C@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-1-2(8)5-3(9)4(10)6(14-5)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | HCJGGGKBFSKUFL-UKFBFLRUSA-N |
| XLogP | -3.10 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|