C8H14O14P2-4 — CID 90658583
[(2R,3R,4S,5S)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-3,4,5-trihydroxyoxan-2-yl] phosphate (PubChem CID 90658583) has the molecular formula C8H14O14P2-4 and a molecular weight of 396.13 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-3,4,5-trihydroxyoxan-2-yl] phosphate.
| Compound Name | [(2R,3R,4S,5S)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-3,4,5-trihydroxyoxan-2-yl] phosphate |
|---|---|
| PubChem CID | 90658583 |
| Molecular Formula | C8H14O14P2-4 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | [(2R,3R,4S,5S)-6-[(1R,2R)-1,2-dihydroxy-3-phosphonatooxypropyl]-3,4,5-trihydroxyoxan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@@H](O)[C@@H](O)C1O[C@H](OP(=O)([O-])[O-])[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H18O14P2/c9-2(1-20-23(14,15)16)3(10)7-5(12)4(11)6(13)8(21-7)22-24(17,18)19/h2-13H,1H2,(H2,14,15,16)(H2,17,18,19)/p-4/t2-,3-,4+,5+,6-,7?,8-/m1/s1 |
| InChIKey | WOBAQQGZCMXPPG-DYFRRQRXSA-J |
| XLogP | -6.79 |
| TPSA | 255.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | -6.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|