C6H11Na2O8P — CID 67062860
disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] phosphate (PubChem CID 67062860) has the molecular formula C6H11Na2O8P and a molecular weight of 288.10 g/mol. Its IUPAC name is disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] phosphate.
| Compound Name | disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] phosphate |
|---|---|
| PubChem CID | 67062860 |
| Molecular Formula | C6H11Na2O8P |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | disodium;[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl] phosphate |
| SMILES | C[C@H]1O[C@@H](OP(=O)([O-])[O-])[C@H](O)[C@@H](O)[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C6H13O8P.2Na/c1-2-3(7)4(8)5(9)6(13-2)14-15(10,11)12;;/h2-9H,1H3,(H2,10,11,12);;/q;2*+1/p-2/t2-,3-,4+,5-,6+;;/m1../s1 |
| InChIKey | JPJQYRZIJVIUSX-UZUGEDCSSA-L |
| XLogP | -9.33 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | -9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|