C9H19O10P — CID 67951833
[(2R)-2-[(3S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-2-hydroxyethyl] dihydrogen phosphate (PubChem CID 67951833) has the molecular formula C9H19O10P and a molecular weight of 318.22 g/mol. Its IUPAC name is [(2R)-2-[(3S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-2-hydroxyethyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-[(3S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-2-hydroxyethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67951833 |
| Molecular Formula | C9H19O10P |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [(2R)-2-[(3S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-2-hydroxyethyl] dihydrogen phosphate |
| SMILES | CCO[C@@H]1OC([C@H](O)COP(=O)(O)O)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C9H19O10P/c1-2-17-9-7(13)5(11)6(12)8(19-9)4(10)3-18-20(14,15)16/h4-13H,2-3H2,1H3,(H2,14,15,16)/t4-,5?,6+,7-,8?,9-/m1/s1 |
| InChIKey | BCUKSHQXULCDJJ-FCWWKUMPSA-N |
| XLogP | -2.70 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|