C8H14O7 — CID 163770117
(3S,5S,6S)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163770117) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is (3S,5S,6S)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3S,5S,6S)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163770117 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (3S,5S,6S)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCO[C@H]1OC(C(=O)O)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C8H14O7/c1-2-14-8-5(11)3(9)4(10)6(15-8)7(12)13/h3-6,8-11H,2H2,1H3,(H,12,13)/t3?,4-,5-,6?,8-/m0/s1 |
| InChIKey | IWJBVMJWSPZNJH-TZDASZDNSA-N |
| XLogP | -2.08 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |