C16H30O7 — CID 11175712
(2S,3S,4S,5S,6S)-6-decoxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 11175712) has the molecular formula C16H30O7 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-decoxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S,6S)-6-decoxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11175712 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-decoxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCCCCCCCCO[C@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H30O7/c1-2-3-4-5-6-7-8-9-10-22-16-13(19)11(17)12(18)14(23-16)15(20)21/h11-14,16-19H,2-10H2,1H3,(H,20,21)/t11-,12-,13-,14-,16-/m0/s1 |
| InChIKey | KEEOEWBDLMXSMK-YGJAXBLXSA-N |
| XLogP | 1.04 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|