C13H26O5 — CID 102241828
(2R,3R,4S,5R,6R)-2-heptoxy-6-methyloxane-3,4,5-triol (PubChem CID 102241828) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-heptoxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-heptoxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 102241828 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-heptoxy-6-methyloxane-3,4,5-triol |
| SMILES | CCCCCCCO[C@@H]1O[C@H](C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H26O5/c1-3-4-5-6-7-8-17-13-12(16)11(15)10(14)9(2)18-13/h9-16H,3-8H2,1-2H3/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | RJMHVODWWXWUDS-KSSYENDESA-N |
| XLogP | 0.80 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|