C18H36O5 — CID 90849789
(3S,4R,5S,6S)-2-dodecoxy-6-methyloxane-3,4,5-triol (PubChem CID 90849789) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3S,4R,5S,6S)-2-dodecoxy-6-methyloxane-3,4,5-triol.
| Compound Name | (3S,4R,5S,6S)-2-dodecoxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 90849789 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | (3S,4R,5S,6S)-2-dodecoxy-6-methyloxane-3,4,5-triol |
| SMILES | CCCCCCCCCCCCOC1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H36O5/c1-3-4-5-6-7-8-9-10-11-12-13-22-18-17(21)16(20)15(19)14(2)23-18/h14-21H,3-13H2,1-2H3/t14-,15+,16+,17-,18?/m0/s1 |
| InChIKey | JYHGYVMSXVZCRF-KIUIKQMISA-N |
| XLogP | 2.75 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|