C14H25O7- — CID 102328386
(3S,4S,5R,6S)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate (PubChem CID 102328386) has the molecular formula C14H25O7- and a molecular weight of 305.35 g/mol. Its IUPAC name is (3S,4S,5R,6S)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate.
| Compound Name | (3S,4S,5R,6S)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 102328386 |
| Molecular Formula | C14H25O7- |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3S,4S,5R,6S)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate |
| SMILES | CCCCCCCCO[C@H]1OC(C(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O7/c1-2-3-4-5-6-7-8-20-14-11(17)9(15)10(16)12(21-14)13(18)19/h9-12,14-17H,2-8H2,1H3,(H,18,19)/p-1/t9-,10-,11+,12?,14-/m0/s1 |
| InChIKey | SYLNWYZPTDDGMH-FDPGKYLASA-M |
| XLogP | -1.08 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|