C9H14O8 — CID 163847394
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propanoyloxyoxane-2-carboxylic acid (PubChem CID 163847394) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propanoyloxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propanoyloxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163847394 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propanoyloxyoxane-2-carboxylic acid |
| SMILES | CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O8/c1-2-3(10)16-9-6(13)4(11)5(12)7(17-9)8(14)15/h4-7,9,11-13H,2H2,1H3,(H,14,15)/t4-,5-,6+,7-,9+/m0/s1 |
| InChIKey | ORJGRZWDRAHVSU-KPRJIFDWSA-N |
| XLogP | -2.17 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |