About (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid
(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid (PubChem CID 130754854) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid.
Analyze (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid?
The IUPAC name of (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid (CID 130754854) is (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid.
What is the SMILES notation for (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid?
The canonical SMILES for (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid is CO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H]1O.
What is the InChIKey of (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid?
The InChIKey is ZXILWSMTRHULKY-BGYOELTMSA-N. The full InChI is InChI=1S/C6H10O6/c1-11-6-3(8)2(7)4(12-6)5(9)10/h2-4,6-8H,1H3,(H,9,10)/t2-,3+,4-,6+/m0/s1.
What are the key properties of (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid?
(2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid has a molecular weight of 178.14 g/mol, XLogP of -1.84, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolane-2-carboxylic acid is sourced from PubChem (CID 130754854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).