3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid

C7H11NO7 — CID 88958522

IUPAC3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid
SMILESCOC1OC(C(=O)O)C(O)C(N=O)C1O
InChIInChI=1S/C7H11NO7/c1-14-7-4(10)2(8-13)3(9)5(15-7)6(11)12/h2-5,7,9-10H,1H3,(H,11,12)
InChIKeyCLGKGRJSIXHHFJ-UHFFFAOYSA-N
MW221.16 g/mol
LogP-1.70
Rot. Bonds3

About 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid

3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid (PubChem CID 88958522) has the molecular formula C7H11NO7 and a molecular weight of 221.16 g/mol. Its IUPAC name is 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid.

Molecular Properties

Compound Name3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid
PubChem CID88958522
Molecular FormulaC7H11NO7
Molecular Weight221.16 g/mol
Exact Mass221.05
IUPAC Name3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid
SMILESCOC1OC(C(=O)O)C(O)C(N=O)C1O
InChIInChI=1S/C7H11NO7/c1-14-7-4(10)2(8-13)3(9)5(15-7)6(11)12/h2-5,7,9-10H,1H3,(H,11,12)
InChIKeyCLGKGRJSIXHHFJ-UHFFFAOYSA-N
XLogP-1.70
TPSA125.65 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.16
LogP ≤ 5-1.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Analyze 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid?
The IUPAC name of 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid (CID 88958522) is 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid.
What is the SMILES notation for 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid?
The canonical SMILES for 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid is COC1OC(C(=O)O)C(O)C(N=O)C1O.
What is the InChIKey of 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid?
The InChIKey is CLGKGRJSIXHHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO7/c1-14-7-4(10)2(8-13)3(9)5(15-7)6(11)12/h2-5,7,9-10H,1H3,(H,11,12).
What are the key properties of 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid?
3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid has a molecular weight of 221.16 g/mol, XLogP of -1.70, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid is sourced from PubChem (CID 88958522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).