C7H11NO7 — CID 88958522
3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid (PubChem CID 88958522) has the molecular formula C7H11NO7 and a molecular weight of 221.16 g/mol. Its IUPAC name is 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid.
| Compound Name | 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid |
|---|---|
| PubChem CID | 88958522 |
| Molecular Formula | C7H11NO7 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3,5-dihydroxy-6-methoxy-4-nitrosooxane-2-carboxylic acid |
| SMILES | COC1OC(C(=O)O)C(O)C(N=O)C1O |
| InChI | InChI=1S/C7H11NO7/c1-14-7-4(10)2(8-13)3(9)5(15-7)6(11)12/h2-5,7,9-10H,1H3,(H,11,12) |
| InChIKey | CLGKGRJSIXHHFJ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |