C8H14O10S — CID 88564904
(3S,4R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 88564904) has the molecular formula C8H14O10S and a molecular weight of 302.26 g/mol. Its IUPAC name is (3S,4R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (3S,4R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 88564904 |
| Molecular Formula | C8H14O10S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (3S,4R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | CO[C@@H]1OC(C(=O)O)[C@@H](OC)[C@@H](O)C1OS(=O)(=O)O |
| InChI | InChI=1S/C8H14O10S/c1-15-4-3(9)5(18-19(12,13)14)8(16-2)17-6(4)7(10)11/h3-6,8-9H,1-2H3,(H,10,11)(H,12,13,14)/t3-,4+,5?,6?,8-/m1/s1 |
| InChIKey | ULTNIHLYTLHSCN-PMRVWCFOSA-N |
| XLogP | -1.99 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|