C14H26NO9+ — CID 157175711
2-(6-carboxy-4-hydroxy-2,5-dimethoxyoxan-3-yl)oxyethyl-(carboxymethyl)-dimethylazanium (PubChem CID 157175711) has the molecular formula C14H26NO9+ and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-(6-carboxy-4-hydroxy-2,5-dimethoxyoxan-3-yl)oxyethyl-(carboxymethyl)-dimethylazanium.
| Compound Name | 2-(6-carboxy-4-hydroxy-2,5-dimethoxyoxan-3-yl)oxyethyl-(carboxymethyl)-dimethylazanium |
|---|---|
| PubChem CID | 157175711 |
| Molecular Formula | C14H26NO9+ |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-(6-carboxy-4-hydroxy-2,5-dimethoxyoxan-3-yl)oxyethyl-(carboxymethyl)-dimethylazanium |
| SMILES | COC1OC(C(=O)O)C(OC)C(O)C1OCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C14H25NO9/c1-15(2,7-8(16)17)5-6-23-11-9(18)10(21-3)12(13(19)20)24-14(11)22-4/h9-12,14,18H,5-7H2,1-4H3,(H-,16,17,19,20)/p+1 |
| InChIKey | HCRARJISIDBPMK-UHFFFAOYSA-O |
| XLogP | -1.64 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|