C14H25NO9 — CID 153301806
(3S,4S,5R)-5-(5-amino-5-carboxypentoxy)-4-hydroxy-3,6-dimethoxyoxane-2-carboxylic acid (PubChem CID 153301806) has the molecular formula C14H25NO9 and a molecular weight of 351.35 g/mol. Its IUPAC name is (3S,4S,5R)-5-(5-amino-5-carboxypentoxy)-4-hydroxy-3,6-dimethoxyoxane-2-carboxylic acid.
| Compound Name | (3S,4S,5R)-5-(5-amino-5-carboxypentoxy)-4-hydroxy-3,6-dimethoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 153301806 |
| Molecular Formula | C14H25NO9 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (3S,4S,5R)-5-(5-amino-5-carboxypentoxy)-4-hydroxy-3,6-dimethoxyoxane-2-carboxylic acid |
| SMILES | COC1OC(C(=O)O)[C@@H](OC)[C@H](O)[C@H]1OCCCCC(N)C(=O)O |
| InChI | InChI=1S/C14H25NO9/c1-21-9-8(16)10(14(22-2)24-11(9)13(19)20)23-6-4-3-5-7(15)12(17)18/h7-11,14,16H,3-6,15H2,1-2H3,(H,17,18)(H,19,20)/t7?,8-,9-,10+,11?,14?/m0/s1 |
| InChIKey | MNHSZZMLLGYZGY-VATARPGRSA-N |
| XLogP | -1.21 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|