About (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid
(3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid (PubChem CID 154471183) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid.
Analyze (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid?
The IUPAC name of (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid (CID 154471183) is (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid.
What is the SMILES notation for (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid?
The canonical SMILES for (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid is CO[C@H]1C(C(=O)O)OC(C)C(O)C1O.
What is the InChIKey of (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid?
The InChIKey is WXZXBILTCQCFBG-VHJXUHCKSA-N. The full InChI is InChI=1S/C8H14O6/c1-3-4(9)5(10)6(13-2)7(14-3)8(11)12/h3-7,9-10H,1-2H3,(H,11,12)/t3?,4?,5?,6-,7?/m1/s1.
What are the key properties of (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid?
(3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid has a molecular weight of 206.19 g/mol, XLogP of -1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,5-dihydroxy-3-methoxy-6-methyloxane-2-carboxylic acid is sourced from PubChem (CID 154471183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).