C5H8O6 — CID 163414752
(4S,5R)-5-hydroxy-4-methoxydioxolane-3-carboxylic acid (PubChem CID 163414752) has the molecular formula C5H8O6 and a molecular weight of 164.11 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-4-methoxydioxolane-3-carboxylic acid.
| Compound Name | (4S,5R)-5-hydroxy-4-methoxydioxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 163414752 |
| Molecular Formula | C5H8O6 |
| Molecular Weight | 164.11 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | (4S,5R)-5-hydroxy-4-methoxydioxolane-3-carboxylic acid |
| SMILES | CO[C@H]1C(C(=O)O)OO[C@H]1O |
| InChI | InChI=1S/C5H8O6/c1-9-3-2(4(6)7)10-11-5(3)8/h2-3,5,8H,1H3,(H,6,7)/t2?,3-,5+/m0/s1 |
| InChIKey | ADLDVIUBDJKNRC-LXDVUGSSSA-N |
| XLogP | -1.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.11 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|