C15H26O11 — CID 91854426
(2S,3S,4R,5R,6S)-4,5,6-trihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid (PubChem CID 91854426) has the molecular formula C15H26O11 and a molecular weight of 382.36 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-4,5,6-trihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6S)-4,5,6-trihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91854426 |
| Molecular Formula | C15H26O11 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2S,3S,4R,5R,6S)-4,5,6-trihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid |
| SMILES | CO[C@H]1[C@H](OC)[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2C(=O)O)O[C@@H](C)[C@H]1OC |
| InChI | InChI=1S/C15H26O11/c1-5-8(21-2)10(22-3)12(23-4)15(24-5)26-9-6(16)7(17)14(20)25-11(9)13(18)19/h5-12,14-17,20H,1-4H3,(H,18,19)/t5-,6+,7+,8+,9-,10+,11-,12-,14-,15-/m0/s1 |
| InChIKey | ZTLQCKHGHFRXLH-CSWFFZMSSA-N |
| XLogP | -2.32 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |