(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid

C8H14O6 — CID 122579172

IUPAC(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid
SMILESCO[C@@H]1C(O)C(C)OC(C(=O)O)[C@H]1O
InChIInChI=1S/C8H14O6/c1-3-4(9)6(13-2)5(10)7(14-3)8(11)12/h3-7,9-10H,1-2H3,(H,11,12)/t3?,4?,5-,6+,7?/m0/s1
InChIKeyADUUKKFZJMALKO-XBDIWLIXSA-N
MW206.19 g/mol
LogP-1.40
Rot. Bonds2

About (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid

(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid (PubChem CID 122579172) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid.

Molecular Properties

Compound Name(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid
PubChem CID122579172
Molecular FormulaC8H14O6
Molecular Weight206.19 g/mol
Exact Mass206.08
IUPAC Name(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid
SMILESCO[C@@H]1C(O)C(C)OC(C(=O)O)[C@H]1O
InChIInChI=1S/C8H14O6/c1-3-4(9)6(13-2)5(10)7(14-3)8(11)12/h3-7,9-10H,1-2H3,(H,11,12)/t3?,4?,5-,6+,7?/m0/s1
InChIKeyADUUKKFZJMALKO-XBDIWLIXSA-N
XLogP-1.40
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.19
LogP ≤ 5-1.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid?
The IUPAC name of (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid (CID 122579172) is (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid.
What is the SMILES notation for (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid?
The canonical SMILES for (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid is CO[C@@H]1C(O)C(C)OC(C(=O)O)[C@H]1O.
What is the InChIKey of (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid?
The InChIKey is ADUUKKFZJMALKO-XBDIWLIXSA-N. The full InChI is InChI=1S/C8H14O6/c1-3-4(9)6(13-2)5(10)7(14-3)8(11)12/h3-7,9-10H,1-2H3,(H,11,12)/t3?,4?,5-,6+,7?/m0/s1.
What are the key properties of (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid?
(3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid has a molecular weight of 206.19 g/mol, XLogP of -1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,5-dihydroxy-4-methoxy-6-methyloxane-2-carboxylic acid is sourced from PubChem (CID 122579172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).