(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid

C7H12O6 — CID 91138099

IUPAC(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid
SMILESC[C@H]1OC(C(=O)O)[C@H](O)C(O)[C@H]1O
InChIInChI=1S/C7H12O6/c1-2-3(8)4(9)5(10)6(13-2)7(11)12/h2-6,8-10H,1H3,(H,11,12)/t2-,3+,4?,5-,6?/m1/s1
InChIKeySFNQYNDFYOQLIZ-YUPKOCPMSA-N
MW192.17 g/mol
LogP-2.06
Rot. Bonds1

About (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid

(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid (PubChem CID 91138099) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid.

Molecular Properties

Compound Name(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid
PubChem CID91138099
Molecular FormulaC7H12O6
Molecular Weight192.17 g/mol
Exact Mass192.06
IUPAC Name(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid
SMILESC[C@H]1OC(C(=O)O)[C@H](O)C(O)[C@H]1O
InChIInChI=1S/C7H12O6/c1-2-3(8)4(9)5(10)6(13-2)7(11)12/h2-6,8-10H,1H3,(H,11,12)/t2-,3+,4?,5-,6?/m1/s1
InChIKeySFNQYNDFYOQLIZ-YUPKOCPMSA-N
XLogP-2.06
TPSA107.22 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 5-2.06
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid?
The IUPAC name of (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid (CID 91138099) is (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid.
What is the SMILES notation for (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid?
The canonical SMILES for (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid is C[C@H]1OC(C(=O)O)[C@H](O)C(O)[C@H]1O.
What is the InChIKey of (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid?
The InChIKey is SFNQYNDFYOQLIZ-YUPKOCPMSA-N. The full InChI is InChI=1S/C7H12O6/c1-2-3(8)4(9)5(10)6(13-2)7(11)12/h2-6,8-10H,1H3,(H,11,12)/t2-,3+,4?,5-,6?/m1/s1.
What are the key properties of (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid?
(3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid has a molecular weight of 192.17 g/mol, XLogP of -2.06, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R,6R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylic acid is sourced from PubChem (CID 91138099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).