C8H14O5 — CID 89099381
1-[(3S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone (PubChem CID 89099381) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 1-[(3S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone.
| Compound Name | 1-[(3S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 89099381 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-[(3S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone |
| SMILES | CC(=O)C1O[C@H](C)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C8H14O5/c1-3(9)8-7(12)6(11)5(10)4(2)13-8/h4-8,10-12H,1-2H3/t4-,5?,6?,7+,8?/m1/s1 |
| InChIKey | KAABDZHOUFIJTQ-HVXQJNDXSA-N |
| XLogP | -1.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |