C11H20O9 — CID 91216486
(2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]pentan-1-one (PubChem CID 91216486) has the molecular formula C11H20O9 and a molecular weight of 296.27 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]pentan-1-one.
| Compound Name | (2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 91216486 |
| Molecular Formula | C11H20O9 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]pentan-1-one |
| SMILES | C[C@H]1OC(C(=O)[C@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O9/c1-3-5(14)7(16)9(18)11(20-3)10(19)8(17)6(15)4(13)2-12/h3-9,11-18H,2H2,1H3/t3-,4-,5+,6+,7+,8-,9-,11?/m1/s1 |
| InChIKey | KNVCGRJSFBGLEP-NSRRRLTJSA-N |
| XLogP | -4.50 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |