C14H24O11 — CID 162456893
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxo-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-2-yl] acetate (PubChem CID 162456893) has the molecular formula C14H24O11 and a molecular weight of 368.34 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxo-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-2-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxo-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-2-yl] acetate |
|---|---|
| PubChem CID | 162456893 |
| Molecular Formula | C14H24O11 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxo-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)C1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H24O11/c1-4-7(18)9(20)11(22)13(24-4)12(23)14(25-5(2)16)10(21)8(19)6(17)3-15/h4,6-11,13-15,17-22H,3H2,1-2H3/t4-,6+,7-,8-,9+,10-,11+,13?,14+/m0/s1 |
| InChIKey | WRHHGUHIZQRUNS-CZWNZXGDSA-N |
| XLogP | -4.57 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |