C18H38O18 — CID 159403758
bis(cyclohexane-1,2,3,4,5,6-hexol);hexane-1,2,3,4,5,6-hexol (PubChem CID 159403758) has the molecular formula C18H38O18 and a molecular weight of 542.48 g/mol. Its IUPAC name is bis(cyclohexane-1,2,3,4,5,6-hexol);hexane-1,2,3,4,5,6-hexol.
| Compound Name | bis(cyclohexane-1,2,3,4,5,6-hexol);hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 159403758 |
| Molecular Formula | C18H38O18 |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | bis(cyclohexane-1,2,3,4,5,6-hexol);hexane-1,2,3,4,5,6-hexol |
| SMILES | OC1C(O)C(O)C(O)C(O)C1O.OC1C(O)C(O)C(O)C(O)C1O.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/2C6H12O6.C6H14O6/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;7-1-3(9)5(11)6(12)4(10)2-8/h2*1-12H;3-12H,1-2H2 |
| InChIKey | LNRNTELJEADEKE-UHFFFAOYSA-N |
| XLogP | -11.25 |
| TPSA | 364.14 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | -11.25 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 18 |