(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid

C8H14O8 — CID 25051954

IUPAC(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid
SMILESCC(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C8H14O8/c1-3(10)16-7(8(14)15)6(13)5(12)4(11)2-9/h4-7,9,11-13H,2H2,1H3,(H,14,15)/t4-,5-,6+,7-/m1/s1
InChIKeyVHLXFMJZYHZQKU-MVIOUDGNSA-N
MW238.19 g/mol
LogP-2.92
Rot. Bonds6

About (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid

(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 25051954) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid.

Molecular Properties

Compound Name(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid
PubChem CID25051954
Molecular FormulaC8H14O8
Molecular Weight238.19 g/mol
Exact Mass238.07
IUPAC Name(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid
SMILESCC(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C8H14O8/c1-3(10)16-7(8(14)15)6(13)5(12)4(11)2-9/h4-7,9,11-13H,2H2,1H3,(H,14,15)/t4-,5-,6+,7-/m1/s1
InChIKeyVHLXFMJZYHZQKU-MVIOUDGNSA-N
XLogP-2.92
TPSA144.52 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.19
LogP ≤ 5-2.92
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Analyze (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid?
The IUPAC name of (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid (CID 25051954) is (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid.
What is the SMILES notation for (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid?
The canonical SMILES for (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid is CC(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO.
What is the InChIKey of (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid?
The InChIKey is VHLXFMJZYHZQKU-MVIOUDGNSA-N. The full InChI is InChI=1S/C8H14O8/c1-3(10)16-7(8(14)15)6(13)5(12)4(11)2-9/h4-7,9,11-13H,2H2,1H3,(H,14,15)/t4-,5-,6+,7-/m1/s1.
What are the key properties of (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid?
(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid has a molecular weight of 238.19 g/mol, XLogP of -2.92, 6 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid is sourced from PubChem (CID 25051954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).