C8H14O8 — CID 25051954
(2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 25051954) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 25051954 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (2R,3S,4R,5R)-2-acetyloxy-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | CC(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H14O8/c1-3(10)16-7(8(14)15)6(13)5(12)4(11)2-9/h4-7,9,11-13H,2H2,1H3,(H,14,15)/t4-,5-,6+,7-/m1/s1 |
| InChIKey | VHLXFMJZYHZQKU-MVIOUDGNSA-N |
| XLogP | -2.92 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |