C10H16O9 — CID 87562113
(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-(2-oxobutanoyloxy)hexanoic acid (PubChem CID 87562113) has the molecular formula C10H16O9 and a molecular weight of 280.23 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-(2-oxobutanoyloxy)hexanoic acid.
| Compound Name | (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-(2-oxobutanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 87562113 |
| Molecular Formula | C10H16O9 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-(2-oxobutanoyloxy)hexanoic acid |
| SMILES | CCC(=O)C(=O)O[C@@H](C(=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O9/c1-2-4(12)10(18)19-8(9(16)17)7(15)6(14)5(13)3-11/h5-8,11,13-15H,2-3H2,1H3,(H,16,17)/t5-,6+,7+,8-/m1/s1 |
| InChIKey | WPEXKWIXLLOPBL-VGRMVHKJSA-N |
| XLogP | -2.96 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|