C7H15NaO9 — CID 86586928
sodium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydrogen carbonate (PubChem CID 86586928) has the molecular formula C7H15NaO9 and a molecular weight of 266.18 g/mol. Its IUPAC name is sodium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydrogen carbonate.
| Compound Name | sodium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydrogen carbonate |
|---|---|
| PubChem CID | 86586928 |
| Molecular Formula | C7H15NaO9 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | sodium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydrogen carbonate |
| SMILES | O=C([O-])O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H14O6.CH2O3.Na/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4;/h3-12H,1-2H2;(H2,2,3,4);/q;;+1/p-1/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | YLTOZVJEXVANQG-MGXNYLRYSA-M |
| XLogP | -7.69 |
| TPSA | 181.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | -7.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |